C21H20N4O3 — CID 130408738
1,3,5-trimethyl-4-[2-oxo-2-(pyridin-2-ylamino)acetyl]-N-phenylpyrrole-2-carboxamide (PubChem CID 130408738) has the molecular formula C21H20N4O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1,3,5-trimethyl-4-[2-oxo-2-(pyridin-2-ylamino)acetyl]-N-phenylpyrrole-2-carboxamide.
| Compound Name | 1,3,5-trimethyl-4-[2-oxo-2-(pyridin-2-ylamino)acetyl]-N-phenylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130408738 |
| Molecular Formula | C21H20N4O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 1,3,5-trimethyl-4-[2-oxo-2-(pyridin-2-ylamino)acetyl]-N-phenylpyrrole-2-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)Nc2ccccn2)c(C)n(C)c1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H20N4O3/c1-13-17(19(26)21(28)24-16-11-7-8-12-22-16)14(2)25(3)18(13)20(27)23-15-9-5-4-6-10-15/h4-12H,1-3H3,(H,23,27)(H,22,24,28) |
| InChIKey | MEFVEOAIJSPPTJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|