C17H14FN3O4 — CID 139551779
ethyl 2-[4-[(3-cyano-4-fluorophenyl)carbamoyl]-1-methylpyrrol-2-yl]-2-oxoacetate (PubChem CID 139551779) has the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. Its IUPAC name is ethyl 2-[4-[(3-cyano-4-fluorophenyl)carbamoyl]-1-methylpyrrol-2-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[(3-cyano-4-fluorophenyl)carbamoyl]-1-methylpyrrol-2-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 139551779 |
| Molecular Formula | C17H14FN3O4 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | ethyl 2-[4-[(3-cyano-4-fluorophenyl)carbamoyl]-1-methylpyrrol-2-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(C(=O)Nc2ccc(F)c(C#N)c2)cn1C |
| InChI | InChI=1S/C17H14FN3O4/c1-3-25-17(24)15(22)14-7-11(9-21(14)2)16(23)20-12-4-5-13(18)10(6-12)8-19/h4-7,9H,3H2,1-2H3,(H,20,23) |
| InChIKey | LPCLSUBMHORWEV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|