C13H10F2N4O3S — CID 144745454
N-(3-cyano-4-fluorophenyl)-3-fluoro-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 144745454) has the molecular formula C13H10F2N4O3S and a molecular weight of 340.31 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-3-fluoro-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-3-fluoro-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 144745454 |
| Molecular Formula | C13H10F2N4O3S |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-3-fluoro-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(N)(=O)=O)c(F)c1C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C13H10F2N4O3S/c1-19-6-10(23(17,21)22)11(15)12(19)13(20)18-8-2-3-9(14)7(4-8)5-16/h2-4,6H,1H3,(H,18,20)(H2,17,21,22) |
| InChIKey | HMKSJPKQLKZJIR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |