C17H16BrFN4O4S — CID 155060306
3-bromo-N-(3-cyano-4-fluorophenyl)-4-[[(2R)-1-hydroxybut-3-en-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 155060306) has the molecular formula C17H16BrFN4O4S and a molecular weight of 471.31 g/mol. Its IUPAC name is 3-bromo-N-(3-cyano-4-fluorophenyl)-4-[[(2R)-1-hydroxybut-3-en-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 3-bromo-N-(3-cyano-4-fluorophenyl)-4-[[(2R)-1-hydroxybut-3-en-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155060306 |
| Molecular Formula | C17H16BrFN4O4S |
| Molecular Weight | 471.31 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | 3-bromo-N-(3-cyano-4-fluorophenyl)-4-[[(2R)-1-hydroxybut-3-en-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | C=C[C@H](CO)NS(=O)(=O)c1cn(C)c(C(=O)Nc2ccc(F)c(C#N)c2)c1Br |
| InChI | InChI=1S/C17H16BrFN4O4S/c1-3-11(9-24)22-28(26,27)14-8-23(2)16(15(14)18)17(25)21-12-4-5-13(19)10(6-12)7-20/h3-6,8,11,22,24H,1,9H2,2H3,(H,21,25)/t11-/m1/s1 |
| InChIKey | SATNEYAXCLTNHM-LLVKDONJSA-N |
| XLogP | 1.88 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|