C20H23FN4O5S — CID 155062071
N-(3-cyano-4-fluorophenyl)-3-[(3S)-3-hydroxy-2-methylhex-5-enoxy]-1-methyl-4-sulfamoylpyrrole-2-carboxamide (PubChem CID 155062071) has the molecular formula C20H23FN4O5S and a molecular weight of 450.49 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-3-[(3S)-3-hydroxy-2-methylhex-5-enoxy]-1-methyl-4-sulfamoylpyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-3-[(3S)-3-hydroxy-2-methylhex-5-enoxy]-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155062071 |
| Molecular Formula | C20H23FN4O5S |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-3-[(3S)-3-hydroxy-2-methylhex-5-enoxy]-1-methyl-4-sulfamoylpyrrole-2-carboxamide |
| SMILES | C=CC[C@H](O)C(C)COc1c(S(N)(=O)=O)cn(C)c1C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C20H23FN4O5S/c1-4-5-16(26)12(2)11-30-19-17(31(23,28)29)10-25(3)18(19)20(27)24-14-6-7-15(21)13(8-14)9-22/h4,6-8,10,12,16,26H,1,5,11H2,2-3H3,(H,24,27)(H2,23,28,29)/t12?,16-/m0/s1 |
| InChIKey | DRNWSSHUKJLCTA-INSVYWFGSA-N |
| XLogP | 1.89 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|