C20H23FN4O3S — CID 154682030
N-(3-cyano-4-fluorophenyl)-1-methyl-3-(2-methylhex-5-enoxy)-4-sulfinamoylpyrrole-2-carboxamide (PubChem CID 154682030) has the molecular formula C20H23FN4O3S and a molecular weight of 418.49 g/mol. Its IUPAC name is N-(3-cyano-4-fluorophenyl)-1-methyl-3-(2-methylhex-5-enoxy)-4-sulfinamoylpyrrole-2-carboxamide.
| Compound Name | N-(3-cyano-4-fluorophenyl)-1-methyl-3-(2-methylhex-5-enoxy)-4-sulfinamoylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 154682030 |
| Molecular Formula | C20H23FN4O3S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-(3-cyano-4-fluorophenyl)-1-methyl-3-(2-methylhex-5-enoxy)-4-sulfinamoylpyrrole-2-carboxamide |
| SMILES | C=CCCC(C)COc1c(S(N)=O)cn(C)c1C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C20H23FN4O3S/c1-4-5-6-13(2)12-28-19-17(29(23)27)11-25(3)18(19)20(26)24-15-7-8-16(21)14(9-15)10-22/h4,7-9,11,13H,1,5-6,12,23H2,2-3H3,(H,24,26) |
| InChIKey | PHIMDPOSAVRWDK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 110.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|