C20H24FN5O2S — CID 146607629
(3R)-N-(3-cyano-4-fluorophenyl)-1-imino-7-methyl-3-(2-methylpropyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 146607629) has the molecular formula C20H24FN5O2S and a molecular weight of 417.51 g/mol. Its IUPAC name is (3R)-N-(3-cyano-4-fluorophenyl)-1-imino-7-methyl-3-(2-methylpropyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-N-(3-cyano-4-fluorophenyl)-1-imino-7-methyl-3-(2-methylpropyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 146607629 |
| Molecular Formula | C20H24FN5O2S |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (3R)-N-(3-cyano-4-fluorophenyl)-1-imino-7-methyl-3-(2-methylpropyl)-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@@H](CC(C)C)CCc2c1cn(C)c2C(=O)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C20H24FN5O2S/c1-12(2)8-15-4-6-16-18(29(23,28)25-15)11-26(3)19(16)20(27)24-14-5-7-17(21)13(9-14)10-22/h5,7,9,11-12,15H,4,6,8H2,1-3H3,(H,24,27)(H2,23,25,28)/t15-,29?/m1/s1 |
| InChIKey | QDQTVRIHHJFTEM-YHVXIASJSA-N |
| XLogP | 3.56 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |