C17H20F2N4O3S — CID 146608823
(3R)-N-(3,4-difluorophenyl)-3-[(1S)-1-hydroxyethyl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 146608823) has the molecular formula C17H20F2N4O3S and a molecular weight of 398.44 g/mol. Its IUPAC name is (3R)-N-(3,4-difluorophenyl)-3-[(1S)-1-hydroxyethyl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-N-(3,4-difluorophenyl)-3-[(1S)-1-hydroxyethyl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 146608823 |
| Molecular Formula | C17H20F2N4O3S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (3R)-N-(3,4-difluorophenyl)-3-[(1S)-1-hydroxyethyl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@@H]([C@H](C)O)CCc2c1cn(C)c2C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H20F2N4O3S/c1-9(24)14-6-4-11-15(27(20,26)22-14)8-23(2)16(11)17(25)21-10-3-5-12(18)13(19)7-10/h3,5,7-9,14,24H,4,6H2,1-2H3,(H,21,25)(H2,20,22,26)/t9-,14+,27?/m0/s1 |
| InChIKey | AACRGKZONZTGTN-DHPWDRGCSA-N |
| XLogP | 2.16 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |