C26H29F3N4O3S — CID 155426172
1-imino-3-[(2S)-4-(4-methoxyphenyl)butan-2-yl]-7-methyl-1-oxo-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 155426172) has the molecular formula C26H29F3N4O3S and a molecular weight of 534.60 g/mol. Its IUPAC name is 1-imino-3-[(2S)-4-(4-methoxyphenyl)butan-2-yl]-7-methyl-1-oxo-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | 1-imino-3-[(2S)-4-(4-methoxyphenyl)butan-2-yl]-7-methyl-1-oxo-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 155426172 |
| Molecular Formula | C26H29F3N4O3S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 1-imino-3-[(2S)-4-(4-methoxyphenyl)butan-2-yl]-7-methyl-1-oxo-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)NC([C@@H](C)CCc2ccc(OC)cc2)CCc2c1cn(C)c2C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C26H29F3N4O3S/c1-15(4-5-16-6-8-18(36-3)9-7-16)22-11-10-19-23(37(30,35)32-22)14-33(2)25(19)26(34)31-17-12-20(27)24(29)21(28)13-17/h6-9,12-15,22H,4-5,10-11H2,1-3H3,(H,31,34)(H2,30,32,35)/t15-,22?,37?/m0/s1 |
| InChIKey | IPJGUNCVWYWWQB-BXUHPKALSA-N |
| XLogP | 5.20 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|