C27H32F2N4OS — CID 146607844
N-(3,4-difluorophenyl)-1-ethylimino-7-methyl-3-(4-phenylbutan-2-yl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 146607844) has the molecular formula C27H32F2N4OS and a molecular weight of 498.64 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-ethylimino-7-methyl-3-(4-phenylbutan-2-yl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1-ethylimino-7-methyl-3-(4-phenylbutan-2-yl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 146607844 |
| Molecular Formula | C27H32F2N4OS |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-ethylimino-7-methyl-3-(4-phenylbutan-2-yl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | CC/N=S1\NC(C(C)CCc2ccccc2)CCc2c1cn(C)c2C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C27H32F2N4OS/c1-4-30-35-25-17-33(3)26(27(34)31-20-12-14-22(28)23(29)16-20)21(25)13-15-24(32-35)18(2)10-11-19-8-6-5-7-9-19/h5-9,12,14,16-18,24H,4,10-11,13,15H2,1-3H3,(H,30,32)(H,31,34) |
| InChIKey | HYWLFDJYQPKRIG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |