C26H29F3N4OS — CID 146607748
7-methyl-1-methylimino-3-(4-phenylbutan-2-yl)-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 146607748) has the molecular formula C26H29F3N4OS and a molecular weight of 502.61 g/mol. Its IUPAC name is 7-methyl-1-methylimino-3-(4-phenylbutan-2-yl)-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | 7-methyl-1-methylimino-3-(4-phenylbutan-2-yl)-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 146607748 |
| Molecular Formula | C26H29F3N4OS |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 7-methyl-1-methylimino-3-(4-phenylbutan-2-yl)-N-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | C/N=S1\NC(C(C)CCc2ccccc2)CCc2c1cn(C)c2C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C26H29F3N4OS/c1-16(9-10-17-7-5-4-6-8-17)22-12-11-19-23(35(30-2)32-22)15-33(3)25(19)26(34)31-18-13-20(27)24(29)21(28)14-18/h4-8,13-16,22H,9-12H2,1-3H3,(H,30,32)(H,31,34) |
| InChIKey | ZQYKGJIPWJUDQF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|