C25H27F3N4O2S — CID 146607521
(3R)-N-(3,4-difluorophenyl)-3-[(2S)-4-(4-fluorophenyl)butan-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 146607521) has the molecular formula C25H27F3N4O2S and a molecular weight of 504.58 g/mol. Its IUPAC name is (3R)-N-(3,4-difluorophenyl)-3-[(2S)-4-(4-fluorophenyl)butan-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-N-(3,4-difluorophenyl)-3-[(2S)-4-(4-fluorophenyl)butan-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 146607521 |
| Molecular Formula | C25H27F3N4O2S |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (3R)-N-(3,4-difluorophenyl)-3-[(2S)-4-(4-fluorophenyl)butan-2-yl]-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@@H]([C@@H](C)CCc2ccc(F)cc2)CCc2c1cn(C)c2C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H27F3N4O2S/c1-15(3-4-16-5-7-17(26)8-6-16)22-12-10-19-23(35(29,34)31-22)14-32(2)24(19)25(33)30-18-9-11-20(27)21(28)13-18/h5-9,11,13-15,22H,3-4,10,12H2,1-2H3,(H,30,33)(H2,29,31,34)/t15-,22+,35?/m0/s1 |
| InChIKey | SAGRQGMSDQEBBI-NCYHQGEISA-N |
| XLogP | 5.19 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |