C19H22F2N4O2S — CID 154991292
(3R)-3-(cyclopropylmethyl)-N-(3,4-difluorophenyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 154991292) has the molecular formula C19H22F2N4O2S and a molecular weight of 408.47 g/mol. Its IUPAC name is (3R)-3-(cyclopropylmethyl)-N-(3,4-difluorophenyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-3-(cyclopropylmethyl)-N-(3,4-difluorophenyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 154991292 |
| Molecular Formula | C19H22F2N4O2S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (3R)-3-(cyclopropylmethyl)-N-(3,4-difluorophenyl)-1-imino-7-methyl-1-oxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]N=S1(=O)N[C@@H](CC2CC2)CCc2c1cn(C)c2C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H22F2N4O2S/c1-25-10-17-14(6-4-13(8-11-2-3-11)24-28(17,22)27)18(25)19(26)23-12-5-7-15(20)16(21)9-12/h5,7,9-11,13H,2-4,6,8H2,1H3,(H,23,26)(H2,22,24,27)/t13-,28?/m1/s1 |
| InChIKey | ZHQDCJFSYPFZIS-OGMHVPHJSA-N |
| XLogP | 3.58 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |