C18H23F2N3O4S2 — CID 159999207
(3S)-N-(3,4-difluorophenyl)-3-(2-hydroxypropan-2-yl)-7-methyl-1,1-dioxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide;sulfane (PubChem CID 159999207) has the molecular formula C18H23F2N3O4S2 and a molecular weight of 447.53 g/mol. Its IUPAC name is (3S)-N-(3,4-difluorophenyl)-3-(2-hydroxypropan-2-yl)-7-methyl-1,1-dioxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide;sulfane.
| Compound Name | (3S)-N-(3,4-difluorophenyl)-3-(2-hydroxypropan-2-yl)-7-methyl-1,1-dioxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide;sulfane |
|---|---|
| PubChem CID | 159999207 |
| Molecular Formula | C18H23F2N3O4S2 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (3S)-N-(3,4-difluorophenyl)-3-(2-hydroxypropan-2-yl)-7-methyl-1,1-dioxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide;sulfane |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(F)c1)CC[C@@H](C(C)(C)O)NS2(=O)=O.S |
| InChI | InChI=1S/C18H21F2N3O4S.H2S/c1-18(2,25)15-7-5-11-14(28(26,27)22-15)9-23(3)16(11)17(24)21-10-4-6-12(19)13(20)8-10;/h4,6,8-9,15,22,25H,5,7H2,1-3H3,(H,21,24);1H2/t15-;/m0./s1 |
| InChIKey | OHYFVYYZOKLHGN-RSAXXLAASA-N |
| XLogP | 2.03 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |