C18H15F4N3O3S — CID 158698673
N-(3-ethynyl-4-fluorophenyl)-7-methyl-1,1-dioxo-3-(trifluoromethyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 158698673) has the molecular formula C18H15F4N3O3S and a molecular weight of 429.40 g/mol. Its IUPAC name is N-(3-ethynyl-4-fluorophenyl)-7-methyl-1,1-dioxo-3-(trifluoromethyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | N-(3-ethynyl-4-fluorophenyl)-7-methyl-1,1-dioxo-3-(trifluoromethyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 158698673 |
| Molecular Formula | C18H15F4N3O3S |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | N-(3-ethynyl-4-fluorophenyl)-7-methyl-1,1-dioxo-3-(trifluoromethyl)-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | C#Cc1cc(NC(=O)c2c3c(cn2C)S(=O)(=O)NC(C(F)(F)F)CC3)ccc1F |
| InChI | InChI=1S/C18H15F4N3O3S/c1-3-10-8-11(4-6-13(10)19)23-17(26)16-12-5-7-15(18(20,21)22)24-29(27,28)14(12)9-25(16)2/h1,4,6,8-9,15,24H,5,7H2,2H3,(H,23,26) |
| InChIKey | XGWICCPAZDMYFC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|