C19H16F4N4O5S — CID 154682113
(3R)-N-(3-cyano-4-fluorophenyl)-7-methyl-1,1-dioxo-3-(1,1,1-trifluoro-2-hydroxybut-3-en-2-yl)-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 154682113) has the molecular formula C19H16F4N4O5S and a molecular weight of 488.42 g/mol. Its IUPAC name is (3R)-N-(3-cyano-4-fluorophenyl)-7-methyl-1,1-dioxo-3-(1,1,1-trifluoro-2-hydroxybut-3-en-2-yl)-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3R)-N-(3-cyano-4-fluorophenyl)-7-methyl-1,1-dioxo-3-(1,1,1-trifluoro-2-hydroxybut-3-en-2-yl)-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 154682113 |
| Molecular Formula | C19H16F4N4O5S |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | (3R)-N-(3-cyano-4-fluorophenyl)-7-methyl-1,1-dioxo-3-(1,1,1-trifluoro-2-hydroxybut-3-en-2-yl)-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | C=CC(O)([C@H]1COc2c(cn(C)c2C(=O)Nc2ccc(F)c(C#N)c2)S(=O)(=O)N1)C(F)(F)F |
| InChI | InChI=1S/C19H16F4N4O5S/c1-3-18(29,19(21,22)23)14-9-32-16-13(33(30,31)26-14)8-27(2)15(16)17(28)25-11-4-5-12(20)10(6-11)7-24/h3-6,8,14,26,29H,1,9H2,2H3,(H,25,28)/t14-,18?/m1/s1 |
| InChIKey | ZHVMXZRGOIKUIX-IKJXHCRLSA-N |
| XLogP | 1.81 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|