C19H19FN4O4S — CID 154682293
(3R)-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1,1-dioxo-3-prop-2-enyl-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 154682293) has the molecular formula C19H19FN4O4S and a molecular weight of 418.45 g/mol. Its IUPAC name is (3R)-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1,1-dioxo-3-prop-2-enyl-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3R)-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1,1-dioxo-3-prop-2-enyl-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 154682293 |
| Molecular Formula | C19H19FN4O4S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (3R)-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1,1-dioxo-3-prop-2-enyl-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | C=CC[C@]1(C)COc2c(cn(C)c2C(=O)Nc2ccc(F)c(C#N)c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C19H19FN4O4S/c1-4-7-19(2)11-28-17-15(29(26,27)23-19)10-24(3)16(17)18(25)22-13-5-6-14(20)12(8-13)9-21/h4-6,8,10,23H,1,7,11H2,2-3H3,(H,22,25)/t19-/m1/s1 |
| InChIKey | PBEHYCGUXBQMDF-LJQANCHMSA-N |
| XLogP | 2.29 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|