C21H20FN5O4S2 — CID 160742573
(3S)-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1,1-dioxo-3-pyridin-2-yl-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide;sulfane (PubChem CID 160742573) has the molecular formula C21H20FN5O4S2 and a molecular weight of 489.55 g/mol. Its IUPAC name is (3S)-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1,1-dioxo-3-pyridin-2-yl-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide;sulfane.
| Compound Name | (3S)-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1,1-dioxo-3-pyridin-2-yl-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide;sulfane |
|---|---|
| PubChem CID | 160742573 |
| Molecular Formula | C21H20FN5O4S2 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (3S)-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1,1-dioxo-3-pyridin-2-yl-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide;sulfane |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(C#N)c1)OC[C@](C)(c1ccccn1)NS2(=O)=O.S |
| InChI | InChI=1S/C21H18FN5O4S.H2S/c1-21(17-5-3-4-8-24-17)12-31-19-16(32(29,30)26-21)11-27(2)18(19)20(28)25-14-6-7-15(22)13(9-14)10-23;/h3-9,11,26H,12H2,1-2H3,(H,25,28);1H2/t21-;/m1./s1 |
| InChIKey | RVTVXJDMVDXQBX-ZMBIFBSDSA-N |
| XLogP | 2.38 |
| TPSA | 126.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |