C16H17Cl2FN4O4S — CID 163206254
N-(3-chloro-4-fluorophenyl)-7-methyl-1,1-dioxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-azetidine]-6-carboxamide;hydrochloride (PubChem CID 163206254) has the molecular formula C16H17Cl2FN4O4S and a molecular weight of 451.31 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-7-methyl-1,1-dioxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-azetidine]-6-carboxamide;hydrochloride.
| Compound Name | N-(3-chloro-4-fluorophenyl)-7-methyl-1,1-dioxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-azetidine]-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 163206254 |
| Molecular Formula | C16H17Cl2FN4O4S |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-methyl-1,1-dioxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-azetidine]-6-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc2c(c1C(=O)Nc1ccc(F)c(Cl)c1)OCC1(CNC1)NS2(=O)=O |
| InChI | InChI=1S/C16H16ClFN4O4S.ClH/c1-22-5-12-14(26-8-16(6-19-7-16)21-27(12,24)25)13(22)15(23)20-9-2-3-11(18)10(17)4-9;/h2-5,19,21H,6-8H2,1H3,(H,20,23);1H |
| InChIKey | GDPSFKHWOFAJHL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |