C18H21F2N3O4S — CID 140762743
3-[(2S)-butan-2-yl]-N-(3,4-difluorophenyl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 140762743) has the molecular formula C18H21F2N3O4S and a molecular weight of 413.45 g/mol. Its IUPAC name is 3-[(2S)-butan-2-yl]-N-(3,4-difluorophenyl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | 3-[(2S)-butan-2-yl]-N-(3,4-difluorophenyl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 140762743 |
| Molecular Formula | C18H21F2N3O4S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 3-[(2S)-butan-2-yl]-N-(3,4-difluorophenyl)-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | CC[C@H](C)C1COc2c(cn(C)c2C(=O)Nc2ccc(F)c(F)c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C18H21F2N3O4S/c1-4-10(2)14-9-27-17-15(28(25,26)22-14)8-23(3)16(17)18(24)21-11-5-6-12(19)13(20)7-11/h5-8,10,14,22H,4,9H2,1-3H3,(H,21,24)/t10-,14?/m0/s1 |
| InChIKey | XJFHMBJQCHVEMY-XLLULAGJSA-N |
| XLogP | 2.64 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |