C18H19F2N3O4S — CID 146336937
N-(3,4-difluorophenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6-diazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 146336937) has the molecular formula C18H19F2N3O4S and a molecular weight of 411.43 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6-diazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6-diazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 146336937 |
| Molecular Formula | C18H19F2N3O4S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6-diazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(F)c1)OCC1CCCC1NS2(=O)=O |
| InChI | InChI=1S/C18H19F2N3O4S/c1-23-8-15-17(27-9-10-3-2-4-14(10)22-28(15,25)26)16(23)18(24)21-11-5-6-12(19)13(20)7-11/h5-8,10,14,22H,2-4,9H2,1H3,(H,21,24) |
| InChIKey | DPXWCMCUWJRCKZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |