C19H21FN4O6S — CID 146336979
7-[(4-fluoro-3-methylphenyl)carbamoyl]-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-13-carboxylic acid (PubChem CID 146336979) has the molecular formula C19H21FN4O6S and a molecular weight of 452.46 g/mol. Its IUPAC name is 7-[(4-fluoro-3-methylphenyl)carbamoyl]-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-13-carboxylic acid.
| Compound Name | 7-[(4-fluoro-3-methylphenyl)carbamoyl]-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-13-carboxylic acid |
|---|---|
| PubChem CID | 146336979 |
| Molecular Formula | C19H21FN4O6S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 7-[(4-fluoro-3-methylphenyl)carbamoyl]-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-13-carboxylic acid |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)(=O)NC2CN(C(=O)O)CC2CO3)ccc1F |
| InChI | InChI=1S/C19H21FN4O6S/c1-10-5-12(3-4-13(10)20)21-18(25)16-17-15(8-23(16)2)31(28,29)22-14-7-24(19(26)27)6-11(14)9-30-17/h3-5,8,11,14,22H,6-7,9H2,1-2H3,(H,21,25)(H,26,27) |
| InChIKey | FQPYMBPVQTVQCI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |