C24H30FN5O6S — CID 155315504
(1R,11R)-13-[2-(tert-butylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 155315504) has the molecular formula C24H30FN5O6S and a molecular weight of 535.60 g/mol. Its IUPAC name is (1R,11R)-13-[2-(tert-butylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | (1R,11R)-13-[2-(tert-butylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 155315504 |
| Molecular Formula | C24H30FN5O6S |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | (1R,11R)-13-[2-(tert-butylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)(=O)N[C@H]2CN(C(=O)C(=O)NC(C)(C)C)C[C@H]2CO3)ccc1F |
| InChI | InChI=1S/C24H30FN5O6S/c1-13-8-15(6-7-16(13)25)26-21(31)19-20-18(11-29(19)5)37(34,35)28-17-10-30(9-14(17)12-36-20)23(33)22(32)27-24(2,3)4/h6-8,11,14,17,28H,9-10,12H2,1-5H3,(H,26,31)(H,27,32)/t14-,17-/m0/s1 |
| InChIKey | FCMZTRPAYFTJSN-YOEHRIQHSA-N |
| XLogP | 1.14 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|