C24H27F4N5O6S — CID 155319224
N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-14-[2-oxo-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-9-oxa-3λ6-thia-2,6,14-triazatricyclo[9.4.0.04,8]pentadeca-4,7-diene-7-carboxamide (PubChem CID 155319224) has the molecular formula C24H27F4N5O6S and a molecular weight of 589.57 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-14-[2-oxo-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-9-oxa-3λ6-thia-2,6,14-triazatricyclo[9.4.0.04,8]pentadeca-4,7-diene-7-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-14-[2-oxo-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-9-oxa-3λ6-thia-2,6,14-triazatricyclo[9.4.0.04,8]pentadeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 155319224 |
| Molecular Formula | C24H27F4N5O6S |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-14-[2-oxo-2-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-9-oxa-3λ6-thia-2,6,14-triazatricyclo[9.4.0.04,8]pentadeca-4,7-diene-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)(=O)NC2CN(C(=O)C(=O)N[C@@H](C)C(F)(F)F)CCC2CO3)ccc1F |
| InChI | InChI=1S/C24H27F4N5O6S/c1-12-8-15(4-5-16(12)25)30-21(34)19-20-18(10-32(19)3)40(37,38)31-17-9-33(7-6-14(17)11-39-20)23(36)22(35)29-13(2)24(26,27)28/h4-5,8,10,13-14,17,31H,6-7,9,11H2,1-3H3,(H,29,35)(H,30,34)/t13-,14?,17?/m0/s1 |
| InChIKey | JHMMPUOAUWQBDM-CBCUQQMYSA-N |
| XLogP | 1.68 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|