C23H25F4N5O6S — CID 155315553
(1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-13-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 155315553) has the molecular formula C23H25F4N5O6S and a molecular weight of 575.54 g/mol. Its IUPAC name is (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-13-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-13-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 155315553 |
| Molecular Formula | C23H25F4N5O6S |
| Molecular Weight | 575.54 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-13-[2-oxo-2-(1,1,1-trifluoropropan-2-ylamino)acetyl]-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)(=O)N[C@H]2CN(C(=O)C(=O)NC(C)C(F)(F)F)C[C@H]2CO3)ccc1F |
| InChI | InChI=1S/C23H25F4N5O6S/c1-11-6-14(4-5-15(11)24)29-20(33)18-19-17(9-31(18)3)39(36,37)30-16-8-32(7-13(16)10-38-19)22(35)21(34)28-12(2)23(25,26)27/h4-6,9,12-13,16,30H,7-8,10H2,1-3H3,(H,28,34)(H,29,33)/t12?,13-,16-/m0/s1 |
| InChIKey | NMSKWSHWNOFLMA-XGFYENRKSA-N |
| XLogP | 1.29 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|