C26H35N5O6S — CID 155724902
N-(3,4-dimethylphenyl)-6-methyl-13-[2-(2-methylbutan-2-ylamino)-2-oxoacetyl]-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 155724902) has the molecular formula C26H35N5O6S and a molecular weight of 545.66 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-6-methyl-13-[2-(2-methylbutan-2-ylamino)-2-oxoacetyl]-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-6-methyl-13-[2-(2-methylbutan-2-ylamino)-2-oxoacetyl]-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 155724902 |
| Molecular Formula | C26H35N5O6S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | N-(3,4-dimethylphenyl)-6-methyl-13-[2-(2-methylbutan-2-ylamino)-2-oxoacetyl]-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | CCC(C)(C)NC(=O)C(=O)N1CC2COc3c(cn(C)c3C(=O)Nc3ccc(C)c(C)c3)S(=O)(=O)NC2C1 |
| InChI | InChI=1S/C26H35N5O6S/c1-7-26(4,5)28-24(33)25(34)31-11-17-14-37-22-20(38(35,36)29-19(17)12-31)13-30(6)21(22)23(32)27-18-9-8-15(2)16(3)10-18/h8-10,13,17,19,29H,7,11-12,14H2,1-6H3,(H,27,32)(H,28,33) |
| InChIKey | IRBISYJXTFYFRC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|