C19H18F3N5O6S — CID 155315604
(1R,11R)-6-methyl-13-oxamoyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 155315604) has the molecular formula C19H18F3N5O6S and a molecular weight of 501.44 g/mol. Its IUPAC name is (1R,11R)-6-methyl-13-oxamoyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | (1R,11R)-6-methyl-13-oxamoyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 155315604 |
| Molecular Formula | C19H18F3N5O6S |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | (1R,11R)-6-methyl-13-oxamoyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | Cn1cc2c(c1C(=O)Nc1cc(F)c(F)c(F)c1)OC[C@@H]1CN(C(=O)C(N)=O)C[C@@H]1NS2(=O)=O |
| InChI | InChI=1S/C19H18F3N5O6S/c1-26-6-13-16(15(26)18(29)24-9-2-10(20)14(22)11(21)3-9)33-7-8-4-27(19(30)17(23)28)5-12(8)25-34(13,31)32/h2-3,6,8,12,25H,4-5,7H2,1H3,(H2,23,28)(H,24,29)/t8-,12-/m0/s1 |
| InChIKey | ADNMVQISMZUDGE-UFBFGSQYSA-N |
| XLogP | -0.32 |
| TPSA | 152.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|