C20H22F3N5O5S — CID 146346524
13-[(2S)-2-aminopropanoyl]-6-methyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 146346524) has the molecular formula C20H22F3N5O5S and a molecular weight of 501.49 g/mol. Its IUPAC name is 13-[(2S)-2-aminopropanoyl]-6-methyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | 13-[(2S)-2-aminopropanoyl]-6-methyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 146346524 |
| Molecular Formula | C20H22F3N5O5S |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 13-[(2S)-2-aminopropanoyl]-6-methyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | C[C@H](N)C(=O)N1CC2COc3c(cn(C)c3C(=O)Nc3cc(F)c(F)c(F)c3)S(=O)(=O)NC2C1 |
| InChI | InChI=1S/C20H22F3N5O5S/c1-9(24)20(30)28-5-10-8-33-18-15(34(31,32)26-14(10)6-28)7-27(2)17(18)19(29)25-11-3-12(21)16(23)13(22)4-11/h3-4,7,9-10,14,26H,5-6,8,24H2,1-2H3,(H,25,29)/t9-,10?,14?/m0/s1 |
| InChIKey | LFFMNNGSKNQPAK-IPWFMCSPSA-N |
| XLogP | 0.54 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|