C18H19F3N4O6S2 — CID 146336944
6-methyl-13-methylsulfonyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 146336944) has the molecular formula C18H19F3N4O6S2 and a molecular weight of 508.50 g/mol. Its IUPAC name is 6-methyl-13-methylsulfonyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | 6-methyl-13-methylsulfonyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 146336944 |
| Molecular Formula | C18H19F3N4O6S2 |
| Molecular Weight | 508.50 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 6-methyl-13-methylsulfonyl-3,3-dioxo-N-(3,4,5-trifluorophenyl)-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | Cn1cc2c(c1C(=O)Nc1cc(F)c(F)c(F)c1)OCC1CN(S(C)(=O)=O)CC1NS2(=O)=O |
| InChI | InChI=1S/C18H19F3N4O6S2/c1-24-7-14-17(16(24)18(26)22-10-3-11(19)15(21)12(20)4-10)31-8-9-5-25(32(2,27)28)6-13(9)23-33(14,29)30/h3-4,7,9,13,23H,5-6,8H2,1-2H3,(H,22,26) |
| InChIKey | MEWURYYQMRJEGG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.50 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|