C21H23F3N4O6S — CID 146363227
ethyl 6-methyl-3,3-dioxo-7-[(3,4,5-trifluorophenyl)carbamoyl]-9-oxa-3λ6-thia-2,6,14-triazatricyclo[10.3.0.04,8]pentadeca-4,7-diene-14-carboxylate (PubChem CID 146363227) has the molecular formula C21H23F3N4O6S and a molecular weight of 516.50 g/mol. Its IUPAC name is ethyl 6-methyl-3,3-dioxo-7-[(3,4,5-trifluorophenyl)carbamoyl]-9-oxa-3λ6-thia-2,6,14-triazatricyclo[10.3.0.04,8]pentadeca-4,7-diene-14-carboxylate.
| Compound Name | ethyl 6-methyl-3,3-dioxo-7-[(3,4,5-trifluorophenyl)carbamoyl]-9-oxa-3λ6-thia-2,6,14-triazatricyclo[10.3.0.04,8]pentadeca-4,7-diene-14-carboxylate |
|---|---|
| PubChem CID | 146363227 |
| Molecular Formula | C21H23F3N4O6S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | ethyl 6-methyl-3,3-dioxo-7-[(3,4,5-trifluorophenyl)carbamoyl]-9-oxa-3λ6-thia-2,6,14-triazatricyclo[10.3.0.04,8]pentadeca-4,7-diene-14-carboxylate |
| SMILES | CCOC(=O)N1CC2CCOc3c(cn(C)c3C(=O)Nc3cc(F)c(F)c(F)c3)S(=O)(=O)NC2C1 |
| InChI | InChI=1S/C21H23F3N4O6S/c1-3-33-21(30)28-8-11-4-5-34-19-16(35(31,32)26-15(11)9-28)10-27(2)18(19)20(29)25-12-6-13(22)17(24)14(23)7-12/h6-7,10-11,15,26H,3-5,8-9H2,1-2H3,(H,25,29) |
| InChIKey | FSKLTKJSYWLYQV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|