C19H19F3N4O4S — CID 175151131
6-methyl-7-[(3,4,5-trifluorophenyl)carbamoyl]-9-oxa-3-thia-2,6,14-triazatricyclo[10.3.0.04,8]pentadeca-4,7-diene-14-carboxylic acid (PubChem CID 175151131) has the molecular formula C19H19F3N4O4S and a molecular weight of 456.45 g/mol. Its IUPAC name is 6-methyl-7-[(3,4,5-trifluorophenyl)carbamoyl]-9-oxa-3-thia-2,6,14-triazatricyclo[10.3.0.04,8]pentadeca-4,7-diene-14-carboxylic acid.
| Compound Name | 6-methyl-7-[(3,4,5-trifluorophenyl)carbamoyl]-9-oxa-3-thia-2,6,14-triazatricyclo[10.3.0.04,8]pentadeca-4,7-diene-14-carboxylic acid |
|---|---|
| PubChem CID | 175151131 |
| Molecular Formula | C19H19F3N4O4S |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 6-methyl-7-[(3,4,5-trifluorophenyl)carbamoyl]-9-oxa-3-thia-2,6,14-triazatricyclo[10.3.0.04,8]pentadeca-4,7-diene-14-carboxylic acid |
| SMILES | Cn1cc2c(c1C(=O)Nc1cc(F)c(F)c(F)c1)OCCC1CN(C(=O)O)CC1NS2 |
| InChI | InChI=1S/C19H19F3N4O4S/c1-25-8-14-17(16(25)18(27)23-10-4-11(20)15(22)12(21)5-10)30-3-2-9-6-26(19(28)29)7-13(9)24-31-14/h4-5,8-9,13,24H,2-3,6-7H2,1H3,(H,23,27)(H,28,29) |
| InChIKey | PERLJTJMHPSDON-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|