C23H25F4N5O3S2 — CID 162619734
(1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-13-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-3,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 162619734) has the molecular formula C23H25F4N5O3S2 and a molecular weight of 559.61 g/mol. Its IUPAC name is (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-13-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-3,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-13-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-3,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 162619734 |
| Molecular Formula | C23H25F4N5O3S2 |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-13-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]-3,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)SN[C@H]2CN(C(=O)C(=O)N[C@H](C)C(F)(F)F)C[C@H]2CS3)ccc1F |
| InChI | InChI=1S/C23H25F4N5O3S2/c1-11-6-14(4-5-15(11)24)29-20(33)18-19-17(9-31(18)3)37-30-16-8-32(7-13(16)10-36-19)22(35)21(34)28-12(2)23(25,26)27/h4-6,9,12-13,16,30H,7-8,10H2,1-3H3,(H,28,34)(H,29,33)/t12-,13+,16+/m1/s1 |
| InChIKey | PRZWZDSEUNVEAT-WWGRRREGSA-N |
| XLogP | 3.32 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|