C24H28FN5O4S2 — CID 155323071
13-[2-(cyclopropylmethylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-6-methyl-3-oxo-3λ4,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 155323071) has the molecular formula C24H28FN5O4S2 and a molecular weight of 533.65 g/mol. Its IUPAC name is 13-[2-(cyclopropylmethylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-6-methyl-3-oxo-3λ4,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | 13-[2-(cyclopropylmethylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-6-methyl-3-oxo-3λ4,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 155323071 |
| Molecular Formula | C24H28FN5O4S2 |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 13-[2-(cyclopropylmethylamino)-2-oxoacetyl]-N-(4-fluoro-3-methylphenyl)-6-methyl-3-oxo-3λ4,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)NC2CN(C(=O)C(=O)NCC4CC4)CC2CS3)ccc1F |
| InChI | InChI=1S/C24H28FN5O4S2/c1-13-7-16(5-6-17(13)25)27-22(31)20-21-19(11-29(20)2)36(34)28-18-10-30(9-15(18)12-35-21)24(33)23(32)26-8-14-3-4-14/h5-7,11,14-15,18,28H,3-4,8-10,12H2,1-2H3,(H,26,32)(H,27,31) |
| InChIKey | NDUPSIJWGFFUAB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|