C20H21FN4O6S2 — CID 155315506
2-[(1R,11R)-7-[(4-fluoro-3-methylphenyl)carbamoyl]-6-methyl-3,3-dioxo-3λ6,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-dien-13-yl]-2-oxoacetic acid (PubChem CID 155315506) has the molecular formula C20H21FN4O6S2 and a molecular weight of 496.54 g/mol. Its IUPAC name is 2-[(1R,11R)-7-[(4-fluoro-3-methylphenyl)carbamoyl]-6-methyl-3,3-dioxo-3λ6,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-dien-13-yl]-2-oxoacetic acid.
| Compound Name | 2-[(1R,11R)-7-[(4-fluoro-3-methylphenyl)carbamoyl]-6-methyl-3,3-dioxo-3λ6,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-dien-13-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 155315506 |
| Molecular Formula | C20H21FN4O6S2 |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 2-[(1R,11R)-7-[(4-fluoro-3-methylphenyl)carbamoyl]-6-methyl-3,3-dioxo-3λ6,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-dien-13-yl]-2-oxoacetic acid |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)(=O)N[C@H]2CN(C(=O)C(=O)O)C[C@H]2CS3)ccc1F |
| InChI | InChI=1S/C20H21FN4O6S2/c1-10-5-12(3-4-13(10)21)22-18(26)16-17-15(8-24(16)2)33(30,31)23-14-7-25(19(27)20(28)29)6-11(14)9-32-17/h3-5,8,11,14,23H,6-7,9H2,1-2H3,(H,22,26)(H,28,29)/t11-,14-/m0/s1 |
| InChIKey | JPSZEIDDHBSJLC-FZMZJTMJSA-N |
| XLogP | 1.02 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|