C22H23F4N5O4S2 — CID 155323032
N-(4-fluoro-3-methylphenyl)-6-methyl-3-oxo-13-[2-oxo-2-(2,2,2-trifluoroethylamino)acetyl]-3λ4,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide (PubChem CID 155323032) has the molecular formula C22H23F4N5O4S2 and a molecular weight of 561.58 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-6-methyl-3-oxo-13-[2-oxo-2-(2,2,2-trifluoroethylamino)acetyl]-3λ4,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-6-methyl-3-oxo-13-[2-oxo-2-(2,2,2-trifluoroethylamino)acetyl]-3λ4,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 155323032 |
| Molecular Formula | C22H23F4N5O4S2 |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-6-methyl-3-oxo-13-[2-oxo-2-(2,2,2-trifluoroethylamino)acetyl]-3λ4,9-dithia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)NC2CN(C(=O)C(=O)NCC(F)(F)F)CC2CS3)ccc1F |
| InChI | InChI=1S/C22H23F4N5O4S2/c1-11-5-13(3-4-14(11)23)28-19(32)17-18-16(8-30(17)2)37(35)29-15-7-31(6-12(15)9-36-18)21(34)20(33)27-10-22(24,25)26/h3-5,8,12,15,29H,6-7,9-10H2,1-2H3,(H,27,33)(H,28,32) |
| InChIKey | PUBATNJCHOLLAT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|