C20H23F2N3OS — CID 139471208
(8Z)-N-(3,4-difluorophenyl)-4,13-dimethyl-2-thia-3,13-diazabicyclo[9.3.0]tetradeca-1(14),8,11-triene-12-carboxamide (PubChem CID 139471208) has the molecular formula C20H23F2N3OS and a molecular weight of 391.49 g/mol. Its IUPAC name is (8Z)-N-(3,4-difluorophenyl)-4,13-dimethyl-2-thia-3,13-diazabicyclo[9.3.0]tetradeca-1(14),8,11-triene-12-carboxamide.
| Compound Name | (8Z)-N-(3,4-difluorophenyl)-4,13-dimethyl-2-thia-3,13-diazabicyclo[9.3.0]tetradeca-1(14),8,11-triene-12-carboxamide |
|---|---|
| PubChem CID | 139471208 |
| Molecular Formula | C20H23F2N3OS |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (8Z)-N-(3,4-difluorophenyl)-4,13-dimethyl-2-thia-3,13-diazabicyclo[9.3.0]tetradeca-1(14),8,11-triene-12-carboxamide |
| SMILES | CC1CCC/C=C\Cc2c(cn(C)c2C(=O)Nc2ccc(F)c(F)c2)SN1 |
| InChI | InChI=1S/C20H23F2N3OS/c1-13-7-5-3-4-6-8-15-18(27-24-13)12-25(2)19(15)20(26)23-14-9-10-16(21)17(22)11-14/h4,6,9-13,24H,3,5,7-8H2,1-2H3,(H,23,26)/b6-4- |
| InChIKey | MZWJQSWVDKVSLC-XQRVVYSFSA-N |
| XLogP | 4.82 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|