C17H18F3N3O3S — CID 139462826
N-[3-(difluoromethyl)-4-fluorophenyl]-3,7-dimethyl-1,1-dioxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 139462826) has the molecular formula C17H18F3N3O3S and a molecular weight of 401.41 g/mol. Its IUPAC name is N-[3-(difluoromethyl)-4-fluorophenyl]-3,7-dimethyl-1,1-dioxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | N-[3-(difluoromethyl)-4-fluorophenyl]-3,7-dimethyl-1,1-dioxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 139462826 |
| Molecular Formula | C17H18F3N3O3S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[3-(difluoromethyl)-4-fluorophenyl]-3,7-dimethyl-1,1-dioxo-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | CC1CCc2c(cn(C)c2C(=O)Nc2ccc(F)c(C(F)F)c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C17H18F3N3O3S/c1-9-3-5-11-14(27(25,26)22-9)8-23(2)15(11)17(24)21-10-4-6-13(18)12(7-10)16(19)20/h4,6-9,16,22H,3,5H2,1-2H3,(H,21,24) |
| InChIKey | GVDAJOLBWDSAGU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |