C20H26F2N4O2S — CID 146607607
(3R)-N-(3,4-difluorophenyl)-1-ethylimino-7-methyl-1-oxo-3-propan-2-yl-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 146607607) has the molecular formula C20H26F2N4O2S and a molecular weight of 424.52 g/mol. Its IUPAC name is (3R)-N-(3,4-difluorophenyl)-1-ethylimino-7-methyl-1-oxo-3-propan-2-yl-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | (3R)-N-(3,4-difluorophenyl)-1-ethylimino-7-methyl-1-oxo-3-propan-2-yl-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 146607607 |
| Molecular Formula | C20H26F2N4O2S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3R)-N-(3,4-difluorophenyl)-1-ethylimino-7-methyl-1-oxo-3-propan-2-yl-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | CCN=S1(=O)N[C@@H](C(C)C)CCc2c1cn(C)c2C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H26F2N4O2S/c1-5-23-29(28)18-11-26(4)19(14(18)7-9-17(25-29)12(2)3)20(27)24-13-6-8-15(21)16(22)10-13/h6,8,10-12,17H,5,7,9H2,1-4H3,(H,24,27)(H,23,25,28)/t17-,29?/m1/s1 |
| InChIKey | ZKUXUFQBEHOEOD-RLDYEDSHSA-N |
| XLogP | 3.88 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |