C16H17F2N3O3S — CID 139471226
N-(3,4-difluorophenyl)-3,4,7-trimethyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 139471226) has the molecular formula C16H17F2N3O3S and a molecular weight of 369.39 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3,4,7-trimethyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-3,4,7-trimethyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 139471226 |
| Molecular Formula | C16H17F2N3O3S |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-3,4,7-trimethyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | CC1NS(=O)c2cn(C)c(C(=O)Nc3ccc(F)c(F)c3)c2OC1C |
| InChI | InChI=1S/C16H17F2N3O3S/c1-8-9(2)24-15-13(25(23)20-8)7-21(3)14(15)16(22)19-10-4-5-11(17)12(18)6-10/h4-9,20H,1-3H3,(H,19,22) |
| InChIKey | ZETTXVQYKVYOEF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |