C16H17F2N3O4S — CID 139471265
N-(3,4-difluorophenyl)-3-(1-hydroxyethyl)-7-methyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 139471265) has the molecular formula C16H17F2N3O4S and a molecular weight of 385.39 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-3-(1-hydroxyethyl)-7-methyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-3-(1-hydroxyethyl)-7-methyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 139471265 |
| Molecular Formula | C16H17F2N3O4S |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-3-(1-hydroxyethyl)-7-methyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | CC(O)C1COc2c(cn(C)c2C(=O)Nc2ccc(F)c(F)c2)S(=O)N1 |
| InChI | InChI=1S/C16H17F2N3O4S/c1-8(22)12-7-25-15-13(26(24)20-12)6-21(2)14(15)16(23)19-9-3-4-10(17)11(18)5-9/h3-6,8,12,20,22H,7H2,1-2H3,(H,19,23) |
| InChIKey | SRKDVHIWJLZUSF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |