C21H19F2N3O3S — CID 139471305
(3R)-3-benzyl-N-(3,4-difluorophenyl)-7-methyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 139471305) has the molecular formula C21H19F2N3O3S and a molecular weight of 431.46 g/mol. Its IUPAC name is (3R)-3-benzyl-N-(3,4-difluorophenyl)-7-methyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3R)-3-benzyl-N-(3,4-difluorophenyl)-7-methyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 139471305 |
| Molecular Formula | C21H19F2N3O3S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (3R)-3-benzyl-N-(3,4-difluorophenyl)-7-methyl-1-oxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(F)c1)OC[C@@H](Cc1ccccc1)NS2=O |
| InChI | InChI=1S/C21H19F2N3O3S/c1-26-11-18-20(19(26)21(27)24-14-7-8-16(22)17(23)10-14)29-12-15(25-30(18)28)9-13-5-3-2-4-6-13/h2-8,10-11,15,25H,9,12H2,1H3,(H,24,27)/t15-,30?/m1/s1 |
| InChIKey | YKTQRJLFDNSGPF-BBUZXQMBSA-N |
| XLogP | 3.17 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |