C23H21FN4O3S — CID 139471334
(3S)-3-benzyl-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1-oxo-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 139471334) has the molecular formula C23H21FN4O3S and a molecular weight of 452.51 g/mol. Its IUPAC name is (3S)-3-benzyl-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1-oxo-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3S)-3-benzyl-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1-oxo-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 139471334 |
| Molecular Formula | C23H21FN4O3S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (3S)-3-benzyl-N-(3-cyano-4-fluorophenyl)-3,7-dimethyl-1-oxo-2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(C#N)c1)OC[C@](C)(Cc1ccccc1)NS2=O |
| InChI | InChI=1S/C23H21FN4O3S/c1-23(11-15-6-4-3-5-7-15)14-31-21-19(32(30)27-23)13-28(2)20(21)22(29)26-17-8-9-18(24)16(10-17)12-25/h3-10,13,27H,11,14H2,1-2H3,(H,26,29)/t23-,32?/m0/s1 |
| InChIKey | GJLOTFFLHGCSCC-SZGIACGNSA-N |
| XLogP | 3.29 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |