C22H25ClFN5O5S — CID 167012213
N-(3-chloro-4-fluorophenyl)-1'-[2-(ethylamino)-2-oxoacetyl]-7-methyl-1-oxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,4'-piperidine]-6-carboxamide (PubChem CID 167012213) has the molecular formula C22H25ClFN5O5S and a molecular weight of 525.99 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1'-[2-(ethylamino)-2-oxoacetyl]-7-methyl-1-oxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,4'-piperidine]-6-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1'-[2-(ethylamino)-2-oxoacetyl]-7-methyl-1-oxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,4'-piperidine]-6-carboxamide |
|---|---|
| PubChem CID | 167012213 |
| Molecular Formula | C22H25ClFN5O5S |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1'-[2-(ethylamino)-2-oxoacetyl]-7-methyl-1-oxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,4'-piperidine]-6-carboxamide |
| SMILES | CCNC(=O)C(=O)N1CCC2(CC1)COc1c(cn(C)c1C(=O)Nc1ccc(F)c(Cl)c1)S(=O)N2 |
| InChI | InChI=1S/C22H25ClFN5O5S/c1-3-25-20(31)21(32)29-8-6-22(7-9-29)12-34-18-16(35(33)27-22)11-28(2)17(18)19(30)26-13-4-5-15(24)14(23)10-13/h4-5,10-11,27H,3,6-9,12H2,1-2H3,(H,25,31)(H,26,30) |
| InChIKey | DOQBENMCLHZFSJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|