C17H18ClFN4O4S — CID 163206211
(3R)-N-(3-chloro-4-fluorophenyl)-7-methyl-1,1-dioxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-6-carboxamide (PubChem CID 163206211) has the molecular formula C17H18ClFN4O4S and a molecular weight of 428.87 g/mol. Its IUPAC name is (3R)-N-(3-chloro-4-fluorophenyl)-7-methyl-1,1-dioxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-6-carboxamide.
| Compound Name | (3R)-N-(3-chloro-4-fluorophenyl)-7-methyl-1,1-dioxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-6-carboxamide |
|---|---|
| PubChem CID | 163206211 |
| Molecular Formula | C17H18ClFN4O4S |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (3R)-N-(3-chloro-4-fluorophenyl)-7-methyl-1,1-dioxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-6-carboxamide |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(Cl)c1)OC[C@]1(CCNC1)NS2(=O)=O |
| InChI | InChI=1S/C17H18ClFN4O4S/c1-23-7-13-15(27-9-17(4-5-20-8-17)22-28(13,25)26)14(23)16(24)21-10-2-3-12(19)11(18)6-10/h2-3,6-7,20,22H,4-5,8-9H2,1H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | XDNQQHABFKBSLJ-QGZVFWFLSA-N |
| XLogP | 1.47 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |