C19H24ClFN4O4S — CID 155315583
(1R,11R)-N-(4-fluoro-3-methylphenyl)-1,6-dimethyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide;hydrochloride (PubChem CID 155315583) has the molecular formula C19H24ClFN4O4S and a molecular weight of 458.94 g/mol. Its IUPAC name is (1R,11R)-N-(4-fluoro-3-methylphenyl)-1,6-dimethyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide;hydrochloride.
| Compound Name | (1R,11R)-N-(4-fluoro-3-methylphenyl)-1,6-dimethyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 155315583 |
| Molecular Formula | C19H24ClFN4O4S |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | (1R,11R)-N-(4-fluoro-3-methylphenyl)-1,6-dimethyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.3.0.04,8]tetradeca-4,7-diene-7-carboxamide;hydrochloride |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)(=O)N[C@@]2(C)CNC[C@H]2CO3)ccc1F.Cl |
| InChI | InChI=1S/C19H23FN4O4S.ClH/c1-11-6-13(4-5-14(11)20)22-18(25)16-17-15(8-24(16)3)29(26,27)23-19(2)10-21-7-12(19)9-28-17;/h4-6,8,12,21,23H,7,9-10H2,1-3H3,(H,22,25);1H/t12-,19-;/m0./s1 |
| InChIKey | MZSHMXZTTQSDLN-UCCPLDSOSA-N |
| XLogP | 1.80 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |