C19H23FN4O4S — CID 155724904
(1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.4.0.04,8]pentadeca-4,7-diene-7-carboxamide (PubChem CID 155724904) has the molecular formula C19H23FN4O4S and a molecular weight of 422.48 g/mol. Its IUPAC name is (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.4.0.04,8]pentadeca-4,7-diene-7-carboxamide.
| Compound Name | (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.4.0.04,8]pentadeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 155724904 |
| Molecular Formula | C19H23FN4O4S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (1R,11R)-N-(4-fluoro-3-methylphenyl)-6-methyl-3,3-dioxo-9-oxa-3λ6-thia-2,6,13-triazatricyclo[9.4.0.04,8]pentadeca-4,7-diene-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c3c(cn2C)S(=O)(=O)N[C@@H]2CCNC[C@H]2CO3)ccc1F |
| InChI | InChI=1S/C19H23FN4O4S/c1-11-7-13(3-4-14(11)20)22-19(25)17-18-16(9-24(17)2)29(26,27)23-15-5-6-21-8-12(15)10-28-18/h3-4,7,9,12,15,21,23H,5-6,8,10H2,1-2H3,(H,22,25)/t12-,15+/m0/s1 |
| InChIKey | HHRBZLXIYMUJMG-SWLSCSKDSA-N |
| XLogP | 1.37 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |