C18H19ClF2N4O3S — CID 166714443
8-chloro-N-(3,4-difluorophenyl)-1',7-dimethyl-1-oxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-6-carboxamide (PubChem CID 166714443) has the molecular formula C18H19ClF2N4O3S and a molecular weight of 444.89 g/mol. Its IUPAC name is 8-chloro-N-(3,4-difluorophenyl)-1',7-dimethyl-1-oxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-6-carboxamide.
| Compound Name | 8-chloro-N-(3,4-difluorophenyl)-1',7-dimethyl-1-oxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-6-carboxamide |
|---|---|
| PubChem CID | 166714443 |
| Molecular Formula | C18H19ClF2N4O3S |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 8-chloro-N-(3,4-difluorophenyl)-1',7-dimethyl-1-oxospiro[2,4-dihydropyrrolo[3,4-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-6-carboxamide |
| SMILES | CN1CCC2(COc3c(c(Cl)n(C)c3C(=O)Nc3ccc(F)c(F)c3)S(=O)N2)C1 |
| InChI | InChI=1S/C18H19ClF2N4O3S/c1-24-6-5-18(8-24)9-28-14-13(25(2)16(19)15(14)29(27)23-18)17(26)22-10-3-4-11(20)12(21)7-10/h3-4,7,23H,5-6,8-9H2,1-2H3,(H,22,26) |
| InChIKey | RRKKDEPKJLELJD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |