C20H20F2N4O4S2 — CID 157382373
(3S)-N-(3,4-difluorophenyl)-7-methyl-1,1-dioxo-3-(pyridin-3-ylmethyl)-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide;sulfane (PubChem CID 157382373) has the molecular formula C20H20F2N4O4S2 and a molecular weight of 482.53 g/mol. Its IUPAC name is (3S)-N-(3,4-difluorophenyl)-7-methyl-1,1-dioxo-3-(pyridin-3-ylmethyl)-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide;sulfane.
| Compound Name | (3S)-N-(3,4-difluorophenyl)-7-methyl-1,1-dioxo-3-(pyridin-3-ylmethyl)-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide;sulfane |
|---|---|
| PubChem CID | 157382373 |
| Molecular Formula | C20H20F2N4O4S2 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (3S)-N-(3,4-difluorophenyl)-7-methyl-1,1-dioxo-3-(pyridin-3-ylmethyl)-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide;sulfane |
| SMILES | Cn1cc2c(c1C(=O)Nc1ccc(F)c(F)c1)OC[C@H](Cc1cccnc1)NS2(=O)=O.S |
| InChI | InChI=1S/C20H18F2N4O4S.H2S/c1-26-10-17-19(18(26)20(27)24-13-4-5-15(21)16(22)8-13)30-11-14(25-31(17,28)29)7-12-3-2-6-23-9-12;/h2-6,8-10,14,25H,7,11H2,1H3,(H,24,27);1H2/t14-;/m0./s1 |
| InChIKey | BLANKVQWXZDNCY-UQKRIMTDSA-N |
| XLogP | 2.35 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |