C17H18FN3O6S — CID 159407598
methyl 6-[(3-fluoro-4-methylphenyl)carbamoyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-3-carboxylate (PubChem CID 159407598) has the molecular formula C17H18FN3O6S and a molecular weight of 411.41 g/mol. Its IUPAC name is methyl 6-[(3-fluoro-4-methylphenyl)carbamoyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-3-carboxylate.
| Compound Name | methyl 6-[(3-fluoro-4-methylphenyl)carbamoyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-3-carboxylate |
|---|---|
| PubChem CID | 159407598 |
| Molecular Formula | C17H18FN3O6S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | methyl 6-[(3-fluoro-4-methylphenyl)carbamoyl]-7-methyl-1,1-dioxo-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-3-carboxylate |
| SMILES | COC(=O)C1COc2c(cn(C)c2C(=O)Nc2ccc(C)c(F)c2)S(=O)(=O)N1 |
| InChI | InChI=1S/C17H18FN3O6S/c1-9-4-5-10(6-11(9)18)19-16(22)14-15-13(7-21(14)2)28(24,25)20-12(8-27-15)17(23)26-3/h4-7,12,20H,8H2,1-3H3,(H,19,22) |
| InChIKey | SFIIZFZPXQUGBZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |