C20H19F6N3O5S — CID 160945505
(3R)-7-methyl-N-[4-methyl-3-(trifluoromethyl)phenyl]-1,1-dioxo-3-[(2S)-1,1,1-trifluoro-2-hydroxybut-3-en-2-yl]-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide (PubChem CID 160945505) has the molecular formula C20H19F6N3O5S and a molecular weight of 527.44 g/mol. Its IUPAC name is (3R)-7-methyl-N-[4-methyl-3-(trifluoromethyl)phenyl]-1,1-dioxo-3-[(2S)-1,1,1-trifluoro-2-hydroxybut-3-en-2-yl]-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide.
| Compound Name | (3R)-7-methyl-N-[4-methyl-3-(trifluoromethyl)phenyl]-1,1-dioxo-3-[(2S)-1,1,1-trifluoro-2-hydroxybut-3-en-2-yl]-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
|---|---|
| PubChem CID | 160945505 |
| Molecular Formula | C20H19F6N3O5S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | (3R)-7-methyl-N-[4-methyl-3-(trifluoromethyl)phenyl]-1,1-dioxo-3-[(2S)-1,1,1-trifluoro-2-hydroxybut-3-en-2-yl]-3,4-dihydro-2H-pyrrolo[3,4-b][1,4,5]oxathiazepine-6-carboxamide |
| SMILES | C=C[C@](O)([C@H]1COc2c(cn(C)c2C(=O)Nc2ccc(C)c(C(F)(F)F)c2)S(=O)(=O)N1)C(F)(F)F |
| InChI | InChI=1S/C20H19F6N3O5S/c1-4-18(31,20(24,25)26)14-9-34-16-13(35(32,33)28-14)8-29(3)15(16)17(30)27-11-6-5-10(2)12(7-11)19(21,22)23/h4-8,14,28,31H,1,9H2,2-3H3,(H,27,30)/t14-,18+/m1/s1 |
| InChIKey | SNHMLARXCVDDGS-KDOFPFPSSA-N |
| XLogP | 3.12 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|